Information card for entry 4066300
| Formula |
C28 H24 B F15 N2 O |
| Calculated formula |
C28 H24 B F15 N2 O |
| SMILES |
[B](c1c(c(c(c(c1F)F)F)F)F)(c1c(c(c(c(c1F)F)F)F)F)(c1c(c(c(c(c1F)F)F)F)F)OCCCC[N+](C)(C)CCN(C)C |
| Title of publication |
Frustrated Lewis Pairs and Ring-Opening of THF, Dioxane, and Thioxane† |
| Authors of publication |
Birkmann, Birgit; Voss, Tanja; Geier, Stephen J.; Ullrich, Matthias; Kehr, Gerald; Erker, Gerhard; Stephan, Douglas W. |
| Journal of publication |
Organometallics |
| Year of publication |
2010 |
| Journal volume |
29 |
| Journal issue |
21 |
| Pages of publication |
5310 |
| a |
11.0576 ± 0.0006 Å |
| b |
12.6641 ± 0.0006 Å |
| c |
20.5009 ± 0.0009 Å |
| α |
90° |
| β |
94.936 ± 0.002° |
| γ |
90° |
| Cell volume |
2860.2 ± 0.2 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0779 |
| Residual factor for significantly intense reflections |
0.0403 |
| Weighted residual factors for significantly intense reflections |
0.0894 |
| Weighted residual factors for all reflections included in the refinement |
0.1044 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.019 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4066300.html