Information card for entry 4070881
| Common name |
(R,Rp)-1d |
| Formula |
C43 H37 Cl5 Fe P2 Pd |
| Calculated formula |
C43 H37 Cl5 Fe P2 Pd |
| SMILES |
[Pd]1(Cl)(Cl)[P](c2c([c]34[Fe]56789%10%11([c]3([cH]5[cH]6[cH]47)[C@H]([P]1(c1ccccc1)c1ccccc1)C)[cH]1[cH]8[cH]9[cH]%10[cH]%111)cccc2)(c1ccccc1)c1ccccc1.C(Cl)(Cl)Cl |
| Title of publication |
Synthesis, Coordination Behavior, and Use in Asymmetric Hydrogenations of Walphos-Type Ligands |
| Authors of publication |
Wang, Yaping; Sturm, Thomas; Steurer, Marianne; Arion, Vladimir B.; Mereiter, Kurt; Spindler, Felix; Weissensteiner, Walter |
| Journal of publication |
Organometallics |
| Year of publication |
2008 |
| Journal volume |
27 |
| Journal issue |
6 |
| Pages of publication |
1119 |
| a |
11.278 ± 0.002 Å |
| b |
14.443 ± 0.003 Å |
| c |
13.142 ± 0.003 Å |
| α |
90° |
| β |
102.8 ± 0.01° |
| γ |
90° |
| Cell volume |
2087.5 ± 0.7 Å3 |
| Cell temperature |
297 ± 2 K |
| Ambient diffraction temperature |
297 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0255 |
| Residual factor for significantly intense reflections |
0.0237 |
| Weighted residual factors for significantly intense reflections |
0.0611 |
| Weighted residual factors for all reflections included in the refinement |
0.0626 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.027 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4070881.html