Information card for entry 4080643
| Formula |
C24 H16 Cl2 Si |
| Calculated formula |
C24 H16 Cl2 Si |
| SMILES |
Cl[Si]1(Cl)c2c(cc(cc2c2ccccc2)c2ccccc2)c2c1cccc2 |
| Title of publication |
Synthesis and Photophysical Properties of Asymmetric Substituted Silafluorenes |
| Authors of publication |
Pusztai, Erika; Toulokhonova, Irina S.; Temple, Nicole; Albright, Haley; Zakai, Uzma I.; Guo, Song; Guzei, Ilia A.; Hu, Rongrong; West, Robert |
| Journal of publication |
Organometallics |
| Year of publication |
2013 |
| Journal volume |
32 |
| Journal issue |
9 |
| Pages of publication |
2529 |
| a |
9.622 ± 0.004 Å |
| b |
10.58 ± 0.004 Å |
| c |
11.616 ± 0.004 Å |
| α |
67.3 ± 0.02° |
| β |
65.942 ± 0.007° |
| γ |
75.289 ± 0.007° |
| Cell volume |
989.6 ± 0.7 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0351 |
| Residual factor for significantly intense reflections |
0.0321 |
| Weighted residual factors for significantly intense reflections |
0.0839 |
| Weighted residual factors for all reflections included in the refinement |
0.0865 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.01 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4080643.html
