Information card for entry 4132449
| Formula |
C19 H27 Br O3 |
| Calculated formula |
C19 H27 Br O3 |
| SMILES |
BrC1=CC[C@@H]2CC[C@H]3[C@@]([C@H](CC[C@@]3([C@@]12C)C)OC(=O)C)(C=O)C.BrC1=CC[C@H]2CC[C@@H]3[C@]([C@@H](CC[C@]3([C@]12C)C)OC(=O)C)(C=O)C |
| Title of publication |
Total Synthesis of (-)-Nodulisporic Acids D, C, and B: Evolution of a Unified Synthetic Strategy. |
| Authors of publication |
Zou, Yike; Li, Xiangqin; Yang, Yun; Berritt, Simon; Melvin, Jason; Gonzales, Stephen; Spafford, Matthew; Smith, 3rd, Amos B |
| Journal of publication |
Journal of the American Chemical Society |
| Year of publication |
2018 |
| Journal volume |
140 |
| Journal issue |
30 |
| Pages of publication |
9502 - 9511 |
| a |
9.8887 ± 0.0006 Å |
| b |
14.8615 ± 0.0008 Å |
| c |
19.586 ± 0.0011 Å |
| α |
73.101 ± 0.003° |
| β |
80.806 ± 0.003° |
| γ |
74.567 ± 0.003° |
| Cell volume |
2644.2 ± 0.3 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0304 |
| Residual factor for significantly intense reflections |
0.0256 |
| Weighted residual factors for significantly intense reflections |
0.0662 |
| Weighted residual factors for all reflections included in the refinement |
0.0687 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.057 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4132449.html