Information card for entry 4133305
| Formula |
C24 H20 B F4 N |
| Calculated formula |
C24 H20 B F4 N |
| SMILES |
[n+]1(C(c2ccccc2)(c2ccccc2)c2ccccc2)ccccc1.[B](F)(F)(F)[F-] |
| Title of publication |
Carbon's Three-Center, Four-Electron Tetrel Bond, Treated Experimentally. |
| Authors of publication |
Karim, Alavi; Schulz, Nils; Andersson, Hanna; Nekoueishahraki, Bijan; Carlsson, Anna-Carin C; Sarabi, Daniel; Valkonen, Arto; Rissanen, Kari; Gräfenstein, Jürgen; Keller, Sandro; Erdélyi, Máté |
| Journal of publication |
Journal of the American Chemical Society |
| Year of publication |
2018 |
| Journal volume |
140 |
| Journal issue |
50 |
| Pages of publication |
17571 - 17579 |
| a |
25.7941 ± 0.0007 Å |
| b |
7.4589 ± 0.0002 Å |
| c |
20.1543 ± 0.0006 Å |
| α |
90° |
| β |
90.743 ± 0.003° |
| γ |
90° |
| Cell volume |
3877.27 ± 0.19 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.1164 |
| Residual factor for significantly intense reflections |
0.1142 |
| Weighted residual factors for significantly intense reflections |
0.3662 |
| Weighted residual factors for all reflections included in the refinement |
0.3671 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.14 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4133305.html