Information card for entry 4516915
| Formula |
C28 H28 N4 O9 S2 |
| Calculated formula |
C28 H28 N4 O9 S2 |
| SMILES |
S(=O)(=O)(Nc1c2c(N(=O)=O)cc(N(=O)=O)c(NS(=O)(=O)c3ccc(cc3)C)c2ccc1)c1ccc(cc1)C.O1CCCC1 |
| Title of publication |
Synthesis of Salts of 1,2,5,6- and 1,4,5,8-Naphthalenetetramine. |
| Authors of publication |
Langis-Barsetti, Sophie; Maris, Thierry; Wuest, James D. |
| Journal of publication |
ACS omega |
| Year of publication |
2017 |
| Journal volume |
2 |
| Journal issue |
9 |
| Pages of publication |
6023 - 6030 |
| a |
9.2281 ± 0.0003 Å |
| b |
10.7423 ± 0.0004 Å |
| c |
15.1969 ± 0.0005 Å |
| α |
81.895 ± 0.002° |
| β |
84.293 ± 0.002° |
| γ |
76.469 ± 0.002° |
| Cell volume |
1446.58 ± 0.09 Å3 |
| Cell temperature |
150 K |
| Ambient diffraction temperature |
150 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0416 |
| Residual factor for significantly intense reflections |
0.0355 |
| Weighted residual factors for significantly intense reflections |
0.0896 |
| Weighted residual factors for all reflections included in the refinement |
0.0935 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.044 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
1.34139 Å |
| Diffraction radiation type |
GaKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4516915.html