Information card for entry 4517255
| Common name |
6,6'-(1,2-phenylene)bis(1,3,5-triazine-2,4-diamine) monohydrate |
| Chemical name |
6,6'-(1,2-phenylene)bis(1,3,5-triazine-2,4-diamine) monohydrate |
| Formula |
C12 H14 N10 O |
| Calculated formula |
C12 H14 N10 O |
| SMILES |
c1(c(cccc1)c1nc(nc(n1)N)N)c1nc(nc(n1)N)N.O |
| Title of publication |
Molecular Organization in Crystals of Bis(diaminotriazinyl)- Substituted Derivatives of Benzene, Pyridine, and Pyrazine |
| Authors of publication |
Adam Duong; Sanil Rajak; Alexandre A. Tremblay; Thierry Maris; James D. Wuest |
| Journal of publication |
Crystal growth and Design |
| Year of publication |
2019 |
| Journal volume |
19 |
| Pages of publication |
1299 |
| a |
8.3259 ± 0.0002 Å |
| b |
9.6536 ± 0.0002 Å |
| c |
10.0614 ± 0.0002 Å |
| α |
109.144 ± 0.001° |
| β |
95.857 ± 0.001° |
| γ |
106.722 ± 0.001° |
| Cell volume |
714.21 ± 0.03 Å3 |
| Cell temperature |
150 K |
| Ambient diffraction temperature |
150 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0443 |
| Residual factor for significantly intense reflections |
0.0387 |
| Weighted residual factors for significantly intense reflections |
0.0968 |
| Weighted residual factors for all reflections included in the refinement |
0.1019 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.078 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
1.34139 Å |
| Diffraction radiation type |
GaKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4517255.html