Information card for entry 4518591
| Formula |
C10 H13 N O4 |
| Calculated formula |
C10 H13 N O4 |
| SMILES |
c1(c(cc(C(=O)OCC)[nH]1)OC(=O)C)C |
| Title of publication |
Practical Synthesis and Application of Halogen-Doped Pyrrole Building Blocks |
| Authors of publication |
Cotman, Andrej Emanuel; Guérin, Thomas; Kovačević, Ivana; Benedetto Tiz, Davide; Durcik, Martina; Fulgheri, Federica; Možina, Štefan; Secci, Daniela; Sterle, Maša; Ilaš, Janez; Zega, Anamarija; Zidar, Nace; Mašič, Lucija Peterlin; Tomašič, Tihomir; Leroux, Frédéric R.; Hanquet, Gilles; Kikelj, Danijel |
| Journal of publication |
ACS Omega |
| Year of publication |
2021 |
| a |
12.3507 ± 0.0005 Å |
| b |
13.6579 ± 0.0006 Å |
| c |
12.1808 ± 0.0005 Å |
| α |
90° |
| β |
90.577 ± 0.002° |
| γ |
90° |
| Cell volume |
2054.61 ± 0.15 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0549 |
| Residual factor for significantly intense reflections |
0.0509 |
| Weighted residual factors for significantly intense reflections |
0.1414 |
| Weighted residual factors for all reflections included in the refinement |
0.1441 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.12 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4518591.html