Information card for entry 7003356
| Chemical name |
N,N'-Dicyclohexyl-N-diphenylphosphino-acetamidine |
| Formula |
C26 H35 N2 P |
| Calculated formula |
C26 H35 N2 P |
| SMILES |
P(N(/C(=N/C1CCCCC1)C)C1CCCCC1)(c1ccccc1)c1ccccc1 |
| Title of publication |
N-Phosphino-amidines and -guanidines: synthesis, structure and P,N-chelate chemistry |
| Authors of publication |
Baiget, Lise; Batsanov, Andrei S.; Dyer, Philip W.; Fox, Mark A.; Hanton, Martin J.; Howard, Judith A. K.; Lane, Philip K.; Solomon, Sophia A. |
| Journal of publication |
Dalton Transactions |
| Year of publication |
2008 |
| Journal issue |
8 |
| Pages of publication |
1043 - 1054 |
| a |
19.45 ± 0.002 Å |
| b |
10.63 ± 0.001 Å |
| c |
22.218 ± 0.002 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
4593.6 ± 0.8 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0885 |
| Residual factor for significantly intense reflections |
0.0776 |
| Weighted residual factors for significantly intense reflections |
0.1482 |
| Weighted residual factors for all reflections included in the refinement |
0.1527 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.323 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7003356.html