Information card for entry 7009184
| Formula |
C25 H27 N3 O |
| Calculated formula |
C25 H27 N3 O |
| SMILES |
n1ccccc1c1nc(ccc1)c1nc(ccc1)O[C@H]1C[C@H]2CC[C@@]1(C2(C)C)C |
| Title of publication |
Regio- and diastereo-selective formation of dicopper(I) and disilver(I) double helicates with chiral 6-substituted 2,2'∶6',2″-terpyridines |
| Authors of publication |
Baum, Gerhard; Constable, Edwin C.; Fenske, Dieter; Housecroft, Catherine E.; Kulke, Torsten; Neuburger, Markus; Zehnder, Margareta |
| Journal of publication |
Journal of the Chemical Society, Dalton Transactions |
| Year of publication |
2000 |
| Journal issue |
6 |
| Pages of publication |
945 |
| a |
13.19 ± 0.002 Å |
| b |
7.75 ± 0.001 Å |
| c |
21.469 ± 0.001 Å |
| α |
90° |
| β |
105.39 ± 0.007° |
| γ |
90° |
| Cell volume |
2115.9 ± 0.4 Å3 |
| Cell temperature |
293 K |
| Ambient diffraction temperature |
293 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for significantly intense reflections |
0.0544 |
| Weighted residual factors for significantly intense reflections |
0.0652 |
| Goodness-of-fit parameter for significantly intense reflections |
0.758 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7009184.html