Information card for entry 7012810
| Formula |
C17 H12 F6 N5 P Pt S3 |
| Calculated formula |
C17 H12 F6 N5 P Pt S3 |
| SMILES |
[Pt]12(SC3SC(=S)NN=3)[n]3ccccc3c3cccc([n]13)c1[n]2cccc1.[P](F)(F)(F)(F)(F)[F-] |
| Title of publication |
Monodentate and bridging coordination of 2,5-dimercapto-1,3,4-thiadiazolate to a (2,2':6',2''-terpyridine)platinum(II) center |
| Authors of publication |
Tannai, Hidenori; Tsuge, Kiyoshi; Sasaki, Yoichi; Hatozaki, Osamu; Oyama, Noboru |
| Journal of publication |
Dalton Transactions |
| Year of publication |
2003 |
| Journal issue |
11 |
| Pages of publication |
2353 - 2358 |
| a |
10.771 ± 0.002 Å |
| b |
11.599 ± 0.003 Å |
| c |
9.66 ± 0.001 Å |
| α |
99.05 ± 0.01° |
| β |
112.839 ± 0.005° |
| γ |
104.803 ± 0.007° |
| Cell volume |
1029.8 ± 0.4 Å3 |
| Cell temperature |
107 K |
| Number of distinct elements |
7 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for significantly intense reflections |
0.0562 |
| Weighted residual factors for all reflections included in the refinement |
0.1429 |
| Goodness-of-fit parameter for all reflections included in the refinement |
2.559 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7012810.html
