Information card for entry 7014082
| Formula |
C46 H36 B Gd N6 O4 |
| Calculated formula |
C46 H36 B Gd N6 O4 |
| SMILES |
[Gd]12345(OC(=CC(=[O]1)c1ccccc1)c1ccccc1)(OC(=CC(=[O]2)c1ccccc1)c1ccccc1)[n]1n(ccc1c1[n]4cccc1)[BH2]n1ccc([n]51)c1[n]3cccc1 |
| Title of publication |
Structural and near-IR photophysical studies on ternary lanthanide complexes containing poly(pyrazolyl)borate and 1,3-diketonate ligands. |
| Authors of publication |
Davies, Graham M.; Aarons, Rebecca J.; Motson, Graham R.; Jeffery, John C.; Adams, Harry; Faulkner, Stephen; Ward, Michael D. |
| Journal of publication |
Dalton transactions (Cambridge, England : 2003) |
| Year of publication |
2004 |
| Journal issue |
8 |
| Pages of publication |
1136 - 1144 |
| a |
19.2403 ± 0.0018 Å |
| b |
26.613 ± 0.002 Å |
| c |
17.8124 ± 0.0016 Å |
| α |
90° |
| β |
117.174 ± 0.001° |
| γ |
90° |
| Cell volume |
8114 ± 1.2 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0655 |
| Residual factor for significantly intense reflections |
0.0377 |
| Weighted residual factors for significantly intense reflections |
0.0737 |
| Weighted residual factors for all reflections included in the refinement |
0.0812 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.992 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7014082.html