Information card for entry 7016014
| Formula |
C31 H29 Cl3 N6 O |
| Calculated formula |
C31 H29 Cl3 N6 O |
| SMILES |
Clc1nc2nc(cc(c2cc1)C)C(c1nc2nc(cc(c2cc1)C)C)=c1[nH]c2nc(cc(c2cc1)C)C.ClCCl.O |
| Title of publication |
Cu(i) and Pb(ii) complexes containing new tris(7-naphthyridyl)methane derivatives: Synthesis, structures, spectroscopy and geometric conversion. |
| Authors of publication |
Gan, Xin; Chi, Shao-Ming; Mu, Wei-Hua; Yao, Jia-Can; Quan, Li; Li, Cong; Bian, Zhao-Yong; Chen, Yong; Fu, Wen-Fu |
| Journal of publication |
Dalton transactions (Cambridge, England : 2003) |
| Year of publication |
2011 |
| Journal volume |
40 |
| Journal issue |
28 |
| Pages of publication |
7365 - 7374 |
| a |
14.215 ± 0.004 Å |
| b |
11.089 ± 0.003 Å |
| c |
18.409 ± 0.005 Å |
| α |
90° |
| β |
101.018 ± 0.004° |
| γ |
90° |
| Cell volume |
2848.3 ± 1.4 Å3 |
| Cell temperature |
113 ± 2 K |
| Ambient diffraction temperature |
113 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0654 |
| Residual factor for significantly intense reflections |
0.0622 |
| Weighted residual factors for significantly intense reflections |
0.1455 |
| Weighted residual factors for all reflections included in the refinement |
0.1478 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.162 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7016014.html