Information card for entry 7018913
| Formula |
C29 H22 N2 O7 |
| Calculated formula |
C29 H22 N2 O7 |
| SMILES |
c1cccc2c1C1(c3ccc(c(c3Oc3c1ccc(c3)O)/C=N/NC(=O)c1ccccc1)O)OC2=O.CO |
| Title of publication |
Recognition of copper and hydrogen sulfide in vitro using a fluorescein derivative indicator |
| Authors of publication |
Hou, Fengping; Cheng, Ju; Xi, Pinxian; Chen, Fengjuan; Huang, Liang; Xie, Gouqiang; Shi, Yanjun; Liu, Hongyan; Bai, Decheng; Zeng, Zhengzhi |
| Journal of publication |
Dalton Transactions |
| Year of publication |
2012 |
| Journal volume |
41 |
| Journal issue |
19 |
| Pages of publication |
5799 |
| a |
7.837 ± 0.004 Å |
| b |
12.342 ± 0.006 Å |
| c |
13.048 ± 0.007 Å |
| α |
108.194 ± 0.005° |
| β |
90.845 ± 0.006° |
| γ |
90.795 ± 0.006° |
| Cell volume |
1198.6 ± 1.1 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.2081 |
| Residual factor for significantly intense reflections |
0.0897 |
| Weighted residual factors for significantly intense reflections |
0.1529 |
| Weighted residual factors for all reflections included in the refinement |
0.1928 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.997 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7018913.html
