Information card for entry 7022684
| Formula |
C25 H29 B N2 |
| Calculated formula |
C25 H29 B N2 |
| SMILES |
N1(C(Nc2c(cccc2C)C)c2c(B1c1ccccc1)cccc2)C(C)(C)C |
| Title of publication |
Reactivity of C,N-chelated organoboron compounds with lithium anilides–formation of unexpected 1,2,3-trisubstituted 1H-2,1-benzazaboroles. |
| Authors of publication |
Hejda, Martin; Lyčka, Antonín; Jambor, Roman; R°užička, Aleš; Dostál, Libor |
| Journal of publication |
Dalton transactions (Cambridge, England : 2003) |
| Year of publication |
2013 |
| Journal volume |
42 |
| Journal issue |
18 |
| Pages of publication |
6417 - 6428 |
| a |
10.3891 ± 0.0009 Å |
| b |
10.225 ± 0.0004 Å |
| c |
20.582 ± 0.0015 Å |
| α |
90° |
| β |
102.468 ± 0.007° |
| γ |
90° |
| Cell volume |
2134.8 ± 0.3 Å3 |
| Cell temperature |
150 ± 1 K |
| Ambient diffraction temperature |
150 ± 1 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0988 |
| Residual factor for significantly intense reflections |
0.0579 |
| Weighted residual factors for significantly intense reflections |
0.1149 |
| Weighted residual factors for all reflections included in the refinement |
0.1388 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.168 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7022684.html