Information card for entry 7024022
| Formula |
C10 H10 N2 S6 |
| Calculated formula |
C10 H10 N2 S6 |
| SMILES |
C1(/SC(=S)N(C1=S)CC)=C1\SC(=S)N(C1=S)CC |
| Title of publication |
A sulfur rich electron acceptor and its [Fe(Cp*)2](+) charge transfer salt with ferromagnetic interactions. |
| Authors of publication |
Le Gal, Yann; Bellec, Nathalie; Barrière, Frédéric; Clérac, Rodolphe; Fourmigué, Marc; Dorcet, Vincent; Roisnel, Thierry; Lorcy, Dominique |
| Journal of publication |
Dalton transactions (Cambridge, England : 2003) |
| Year of publication |
2013 |
| Journal volume |
42 |
| Journal issue |
48 |
| Pages of publication |
16672 - 16675 |
| a |
7.4387 ± 0.0005 Å |
| b |
8.1655 ± 0.0007 Å |
| c |
12.5242 ± 0.0009 Å |
| α |
108.826 ± 0.004° |
| β |
101.941 ± 0.004° |
| γ |
91.319 ± 0.004° |
| Cell volume |
701.13 ± 0.09 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0417 |
| Residual factor for significantly intense reflections |
0.0332 |
| Weighted residual factors for significantly intense reflections |
0.0716 |
| Weighted residual factors for all reflections included in the refinement |
0.075 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.033 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7024022.html