Information card for entry 7024225
| Formula |
C17 H15 Ag F3 N3 O3 S |
| Calculated formula |
C17 H15 Ag F3 N3 O3 S |
| SMILES |
[Ag]1([n]2c3c4[n]1c(ccc4ccc3ccc2C)C)[N]#CC.S(=O)(=O)([O-])C(F)(F)F |
| Title of publication |
Syntheses, structures and spectroscopy of uni- and bi-dentate nitrogen base complexes of silver(I) trifluoromethanesulfonate. |
| Authors of publication |
Di Nicola, Corrado; Effendy,; Marchetti, Fabio; Nervi, Carlo; Pettinari, Claudio; Robinson, Ward T.; Sobolev, Alexandre N.; White, Allan H. |
| Journal of publication |
Dalton transactions (Cambridge, England : 2003) |
| Year of publication |
2010 |
| Journal volume |
39 |
| Journal issue |
3 |
| Pages of publication |
908 - 922 |
| a |
6.8923 ± 0.0003 Å |
| b |
11.5979 ± 0.0005 Å |
| c |
12.8904 ± 0.0006 Å |
| α |
112.621 ± 0.001° |
| β |
97.228 ± 0.001° |
| γ |
99.359 ± 0.001° |
| Cell volume |
918.19 ± 0.07 Å3 |
| Cell temperature |
150 K |
| Ambient diffraction temperature |
150 K |
| Number of distinct elements |
7 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.041 |
| Residual factor for significantly intense reflections |
0.027 |
| Weighted residual factors for all reflections |
0.036 |
| Weighted residual factors for all reflections included in the refinement |
0.033 |
| Goodness-of-fit parameter for all reflections |
0.975 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.014 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7024225.html
