Information card for entry 7026795
| Chemical name |
[2,6-bis-(2,4,6-trimethylphenyl)phenyl]amino(dichloro)arsane |
| Formula |
C24 H26 As Cl2 N |
| Calculated formula |
C24 H26 As Cl2 N |
| SMILES |
[As](Cl)(Cl)Nc1c(cccc1c1c(cc(cc1C)C)C)c1c(cc(cc1C)C)C |
| Title of publication |
Synthesis of sterically encumbered 2,4-bis-m-terphenyl-1,3-dichloro-2,4-cyclo-dipnictadiazanes [m-TerNPnCl](2), (Pn = P, As). |
| Authors of publication |
Reiss, Fabian; Schulz, Axel; Villinger, Alexander; Weding, Nico |
| Journal of publication |
Dalton transactions (Cambridge, England : 2003) |
| Year of publication |
2010 |
| Journal volume |
39 |
| Journal issue |
41 |
| Pages of publication |
9962 - 9972 |
| a |
24.301 ± 0.005 Å |
| b |
10.58 ± 0.002 Å |
| c |
8.842 ± 0.0018 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2273.3 ± 0.8 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P n a 21 |
| Hall space group symbol |
P 2c -2n |
| Residual factor for all reflections |
0.0346 |
| Residual factor for significantly intense reflections |
0.0251 |
| Weighted residual factors for significantly intense reflections |
0.0578 |
| Weighted residual factors for all reflections included in the refinement |
0.0608 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.021 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7026795.html