Information card for entry 7037789
| Formula |
C23 H21 N5 O |
| Calculated formula |
C23 H21 N5 O |
| SMILES |
O1CCN(c2ncnc(n3nc(cc3c3ccccc3)c3ccccc3)c2)CC1 |
| Title of publication |
Mixed-valence copper(i,ii) complexes with 4-(1H-pyrazol-1-yl)-6-R-pyrimidines: from ionic structures to coordination polymers. |
| Authors of publication |
Vinogradova, Katerina A.; Krivopalov, Viktor P.; Nikolaenkova, Elena B.; Pervukhina, Natalia V.; Naumov, Dmitrii Yu; Boguslavsky, Evgenii G.; Bushuev, Mark B. |
| Journal of publication |
Dalton transactions (Cambridge, England : 2003) |
| Year of publication |
2015 |
| Journal volume |
45 |
| Journal issue |
2 |
| Pages of publication |
515 - 524 |
| a |
11.6372 ± 0.0011 Å |
| b |
7.5691 ± 0.0006 Å |
| c |
21.511 ± 0.002 Å |
| α |
90° |
| β |
94.403 ± 0.003° |
| γ |
90° |
| Cell volume |
1889.2 ± 0.3 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.051 |
| Residual factor for significantly intense reflections |
0.036 |
| Weighted residual factors for significantly intense reflections |
0.0871 |
| Weighted residual factors for all reflections included in the refinement |
0.0918 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.047 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7037789.html