Information card for entry 7039364
| Formula |
C43 H34 O3 P2 Pt |
| Calculated formula |
C43 H34 O3 P2 Pt |
| SMILES |
[Pt]1([P](c2ccccc2)(c2ccccc2)c2ccccc2)([P](c2ccccc2)(c2ccccc2)c2ccccc2)OC(=O)c2c(O1)cccc2 |
| Title of publication |
Bis(dimethylsulfoxide)carbonateplatinum(ii), a new synthon for a low-impact, versatile synthetic route to anticancer Pt carboxylates. |
| Authors of publication |
Bergamini, Paola; Marvelli, Lorenza; Ferretti, Valeria; Gemmo, Chiara; Gambari, Roberto; Hushcha, Yekatsiaryna; Lampronti, Ilaria |
| Journal of publication |
Dalton transactions (Cambridge, England : 2003) |
| Year of publication |
2016 |
| Journal volume |
45 |
| Journal issue |
26 |
| Pages of publication |
10752 - 10760 |
| a |
11.2726 ± 0.0002 Å |
| b |
12.5875 ± 0.0003 Å |
| c |
14.9124 ± 0.0003 Å |
| α |
107.454 ± 0.0012° |
| β |
99.969 ± 0.0015° |
| γ |
103.422 ± 0.0011° |
| Cell volume |
1895.05 ± 0.07 Å3 |
| Cell temperature |
295 K |
| Ambient diffraction temperature |
295 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.049 |
| Residual factor for significantly intense reflections |
0.0384 |
| Weighted residual factors for significantly intense reflections |
0.0941 |
| Weighted residual factors for all reflections included in the refinement |
0.0987 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.058 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7039364.html
