Information card for entry 7043561
| Formula |
C35 H34 Cl2 Fe P2 S |
| Calculated formula |
C35 H34 Cl2 Fe P2 S |
| SMILES |
Cl[Fe]1([P](c2ccccc2)(CC(CSc2ccccc2)(C[P]1(c1ccccc1)c1ccccc1)C)c1ccccc1)Cl |
| Title of publication |
Spectroscopic and Reactivity Differences in Metal Complexes Derived from Sulfur Containing Triphos Homologs |
| Authors of publication |
Petuker, Anette; Gerschel, Philipp; Piontek, Stefan; Ritterskamp, Nadine; Wittkamp, Florian; Iffland, Linda; Miller, Reece Graham; van Gastel, Maurice; Apfel, Ulf-Peter |
| Journal of publication |
Dalton Trans. |
| Year of publication |
2017 |
| a |
18.571 ± 0.014 Å |
| b |
17.955 ± 0.014 Å |
| c |
9.942 ± 0.011 Å |
| α |
90° |
| β |
90.48 ± 0.02° |
| γ |
90° |
| Cell volume |
3315 ± 5 Å3 |
| Cell temperature |
293 K |
| Ambient diffraction temperature |
293 K |
| Number of distinct elements |
6 |
| Space group number |
9 |
| Hermann-Mauguin space group symbol |
C 1 c 1 |
| Hall space group symbol |
C -2yc |
| Residual factor for all reflections |
0.0555 |
| Residual factor for significantly intense reflections |
0.0483 |
| Weighted residual factors for significantly intense reflections |
0.1233 |
| Weighted residual factors for all reflections included in the refinement |
0.1414 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.097 |
| Diffraction radiation wavelength |
0.71075 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7043561.html
