Information card for entry 7050407
| Formula |
C13 H15 N2 O2.5 S |
| Calculated formula |
C13 H15 N2 O2.5 S |
| SMILES |
S(=O)(=O)(NCc1ncccc1)c1ccc(C)cc1.O |
| Title of publication |
Examination of cobalt, nickel, copper and zinc(ii) complex geometry and binding affinity in aqueous media using simple pyridylsulfonamide ligands |
| Authors of publication |
Congreve, Aileen; Kataky, Ritu; Knell, Mark; Parker, David; Puschmann, Horst; Senanayake, Kanthi; Wylie, Lisa |
| Journal of publication |
New Journal of Chemistry |
| Year of publication |
2003 |
| Journal volume |
27 |
| Journal issue |
1 |
| Pages of publication |
98 - 106 |
| a |
26.831 ± 0.004 Å |
| b |
5.9583 ± 0.0008 Å |
| c |
16.576 ± 0.002 Å |
| α |
90° |
| β |
99.967 ± 0.003° |
| γ |
90° |
| Cell volume |
2610 ± 0.6 Å3 |
| Cell temperature |
110 ± 2 K |
| Ambient diffraction temperature |
110 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0428 |
| Residual factor for significantly intense reflections |
0.0384 |
| Weighted residual factors for significantly intense reflections |
0.092 |
| Weighted residual factors for all reflections included in the refinement |
0.0943 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.212 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7050407.html