Information card for entry 7103894
| Common name |
2,5,2',5'-tetrakis-bromomethyl-biphenyl |
| Formula |
C16 H14 Br4 |
| Calculated formula |
C16 H14 Br4 |
| SMILES |
BrCc1ccc(CBr)c(c1)c1c(CBr)ccc(CBr)c1 |
| Title of publication |
Synthesis, characteristics and luminescence properties of oligo(phenylenevinylene) dimers with a biphenyl linkage center |
| Authors of publication |
He, Feng; Cheng, Gang; Zhang, Haiquan; Zheng, Yan; Xie, Zengqi; Yang, Bing; Ma, Yuguang; Liu, Shiyong; Shen, Jiacong |
| Journal of publication |
Chemical Communications (Cambridge, United Kingdom) |
| Year of publication |
2003 |
| Journal issue |
17 |
| Pages of publication |
2206 - 2207 |
| a |
9.184 ± 0.002 Å |
| b |
9.3868 ± 0.0015 Å |
| c |
11.5616 ± 0.0008 Å |
| α |
108.581 ± 0.011° |
| β |
93.72 ± 0.006° |
| γ |
109.933 ± 0.015° |
| Cell volume |
871.2 ± 0.3 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.11 |
| Residual factor for significantly intense reflections |
0.0646 |
| Weighted residual factors for significantly intense reflections |
0.1786 |
| Weighted residual factors for all reflections included in the refinement |
0.198 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.046 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKa |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7103894.html