Information card for entry 7120511
| Formula |
C19 H17 N2 O2 |
| Calculated formula |
C18 H17 N3 O2 |
| SMILES |
O(C(=O)n1nc(nc1c1cc(ccc1)C)c1ccccc1)CC |
| Title of publication |
Visible Light-Induced Cyclization Reactions for the Synthesis of 1,2,4-triazolines and 1,2,4-Triazoles |
| Authors of publication |
Wang, Hongyu; Ren, Yanfei; Wang, Kaiye; Man, Yunquan; Xiang, Yanan; Li, Na; Tang, Bo |
| Journal of publication |
Chem. Commun. |
| Year of publication |
2017 |
| a |
10.5368 ± 0.0003 Å |
| b |
10.0023 ± 0.0002 Å |
| c |
15.9591 ± 0.0005 Å |
| α |
90° |
| β |
103.66 ± 0.003° |
| γ |
90° |
| Cell volume |
1634.39 ± 0.08 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0513 |
| Residual factor for significantly intense reflections |
0.0443 |
| Weighted residual factors for significantly intense reflections |
0.1147 |
| Weighted residual factors for all reflections included in the refinement |
0.1225 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.066 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7120511.html