Information card for entry 7120611
| Formula |
C21 H23 Cl N4 O3 S |
| Calculated formula |
C21 H23 Cl N4 O3 S |
| SMILES |
[Cl-].s1c(N2C(=O)c3cccc4c(N5CC[NH+](C)CC5)ccc(C2=O)c34)ncc1C.O |
| Title of publication |
Lysosomal tracking with a cationic naphthalimide using multiphoton fluorescence lifetime imaging microscopy |
| Authors of publication |
Pascu, Sofia; Li, Meng; Ge, Haobo; Mirabello, Vincenzo; Arrowsmith, Rory L.; Kociok-Kohn, Gabriele; Botchway, Stanley W.; Zhu, Weihong; James, Tony D. |
| Journal of publication |
Chem. Commun. |
| Year of publication |
2017 |
| a |
7.2813 ± 0.0002 Å |
| b |
9.4897 ± 0.0003 Å |
| c |
15.4934 ± 0.0006 Å |
| α |
91.1888 ± 0.0012° |
| β |
101.801 ± 0.0012° |
| γ |
100.768 ± 0.0015° |
| Cell volume |
1027.54 ± 0.06 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0629 |
| Residual factor for significantly intense reflections |
0.0406 |
| Weighted residual factors for significantly intense reflections |
0.089 |
| Weighted residual factors for all reflections included in the refinement |
0.097 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.032 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7120611.html