Information card for entry 7126637
| Formula |
C21 H15 F N2 |
| Calculated formula |
C21 H15 F N2 |
| SMILES |
Fc1cccc(C2=NC(N=C2)(c2ccccc2)c2ccccc2)c1 |
| Title of publication |
Copper-catalyzed [2+3]-annulation of N-H imines with vinyl azides: access to polyaryl 2H-imidazoles. |
| Authors of publication |
Zhu, Zhongzhi; Lin, Hanze; Liang, Baihui; Huang, Junjie; Liang, Wanyi; Chen, Lu; Huang, Yubing; Chen, Xiuwen; Li, Yibiao |
| Journal of publication |
Chemical communications (Cambridge, England) |
| Year of publication |
2020 |
| Journal volume |
56 |
| Journal issue |
42 |
| Pages of publication |
5621 - 5624 |
| a |
8.768 ± 0.007 Å |
| b |
9.173 ± 0.007 Å |
| c |
10.452 ± 0.008 Å |
| α |
89.574 ± 0.009° |
| β |
84.573 ± 0.009° |
| γ |
78.861 ± 0.009° |
| Cell volume |
821.1 ± 1.1 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296.15 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0829 |
| Residual factor for significantly intense reflections |
0.0491 |
| Weighted residual factors for significantly intense reflections |
0.1219 |
| Weighted residual factors for all reflections included in the refinement |
0.1401 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.017 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7126637.html
