Information card for entry 7127181
| Formula |
C20 H28 B P |
| Calculated formula |
C20 H28 B P |
| SMILES |
[BH3][P@](c1cc2c(cc1)c1c(C2(C)C)cccc1)(C)C(C)(C)C |
| Title of publication |
Synthesis of P-chiral phosphine compounds by palladium-catalyzed C-P coupling reactions. |
| Authors of publication |
Wang, Cuiying; Yue, Chang-Duo; Yuan, Jia; Zheng, Jia-Lian; Zhang, Ying; Yu, Hong; Chen, Jian; Meng, Sixuan; Yu, Yang; Yu, Guang-Ao; Che, Chi-Ming |
| Journal of publication |
Chemical communications (Cambridge, England) |
| Year of publication |
2020 |
| Journal volume |
56 |
| Journal issue |
79 |
| Pages of publication |
11775 - 11778 |
| a |
11.2902 ± 0.0016 Å |
| b |
12.3392 ± 0.0018 Å |
| c |
13.6341 ± 0.0019 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1899.4 ± 0.5 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.041 |
| Residual factor for significantly intense reflections |
0.0358 |
| Weighted residual factors for significantly intense reflections |
0.0948 |
| Weighted residual factors for all reflections included in the refinement |
0.1017 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.078 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7127181.html