Information card for entry 7127482
| Formula |
C17 H18 F6 N3 P |
| Calculated formula |
C17 H18 F6 N3 P |
| SMILES |
C(=C\c1ccc(cc1)N(C)C)(c1cc[n+](cc1)C)\C#N.[P](F)(F)(F)(F)(F)[F-] |
| Title of publication |
Optimising molecular rotors to AIE fluorophores for mitochondria uptake and retention. |
| Authors of publication |
OwYong, Tze Cin; Ding, Siyang; Wu, Na; Fellowes, Thomas; Chen, Sijie; White, Jonathan M.; Wong, Wallace W. H.; Hong, Yuning |
| Journal of publication |
Chemical communications (Cambridge, England) |
| Year of publication |
2020 |
| Journal volume |
56 |
| Journal issue |
94 |
| Pages of publication |
14853 - 14856 |
| a |
6.352 ± 0.0001 Å |
| b |
8.2274 ± 0.0001 Å |
| c |
33.0348 ± 0.0006 Å |
| α |
90° |
| β |
91.298 ± 0.001° |
| γ |
90° |
| Cell volume |
1725.97 ± 0.05 Å3 |
| Cell temperature |
100 ± 0.1 K |
| Ambient diffraction temperature |
100.2 ± 0.6 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0736 |
| Residual factor for significantly intense reflections |
0.0459 |
| Weighted residual factors for significantly intense reflections |
0.1353 |
| Weighted residual factors for all reflections included in the refinement |
0.1504 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.086 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7127482.html