Information card for entry 7151863
| Chemical name |
rac-(2S,4S,6S)-2,10-dimethyl-2,3,4,6-tetrahydro-1H-2,6-methanobenzo[c]- [1,5]oxazocin-4-ol |
| Formula |
C13 H17 N O2 |
| Calculated formula |
C13 H17 N O2 |
| SMILES |
N1[C@@]2(C)C[C@H](O)O[C@@H](c3cccc(C)c13)C2.N1[C@]2(C)C[C@@H](O)O[C@H](c3cccc(C)c13)C2 |
| Title of publication |
Synthetic studies towards marmycins A and B: development of the vinylogous aldol-aza-Michael domino reaction. |
| Authors of publication |
Bourcet, Emmanuel; Bröhmer, Manuel C; Nieger, Martin; Bräse, Stefan |
| Journal of publication |
Organic & biomolecular chemistry |
| Year of publication |
2011 |
| Journal volume |
9 |
| Journal issue |
9 |
| Pages of publication |
3136 - 3138 |
| a |
7.5344 ± 0.0006 Å |
| b |
22.298 ± 0.0013 Å |
| c |
7.2117 ± 0.0007 Å |
| α |
90° |
| β |
114.172 ± 0.007° |
| γ |
90° |
| Cell volume |
1105.35 ± 0.16 Å3 |
| Cell temperature |
123 ± 2 K |
| Ambient diffraction temperature |
123 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0438 |
| Residual factor for significantly intense reflections |
0.0403 |
| Weighted residual factors for significantly intense reflections |
0.1004 |
| Weighted residual factors for all reflections included in the refinement |
0.1033 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.078 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7151863.html