Information card for entry 7155380
| Chemical name |
(3R,4R,5R)-2,4,6,6-tetramethyloct-7-ene-3,5-diol |
| Formula |
C12 H24 O2 |
| Calculated formula |
C12 H24 O2 |
| SMILES |
O[C@H]([C@@H]([C@H](O)C(C)C)C)C(C=C)(C)C |
| Title of publication |
Synthesis and biological evaluation of simplified pironetin analogues with modifications in the side chain and the lactone ring. |
| Authors of publication |
Roldán, Steven; Cardona, Adrià; Conesa, Laura; Murga, Juan; Falomir, Eva; Carda, Miguel; Marco, J. Alberto |
| Journal of publication |
Organic & biomolecular chemistry |
| Year of publication |
2016 |
| Journal volume |
15 |
| Journal issue |
1 |
| Pages of publication |
220 - 232 |
| a |
6.3617 ± 0.0003 Å |
| b |
10.0016 ± 0.0003 Å |
| c |
20.4847 ± 0.0007 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1303.38 ± 0.09 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0591 |
| Residual factor for significantly intense reflections |
0.0523 |
| Weighted residual factors for significantly intense reflections |
0.1572 |
| Weighted residual factors for all reflections included in the refinement |
0.1639 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.195 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7155380.html