Information card for entry 7155889
| Chemical name |
ethyl 3-hydroxy-5-methyl-2-(4-(<i>m</i>-tolyl)-1<i>H</i>-1,2,3-triazol-1-yl)-[1,1'-\ biphenyl]-4- carboxylate |
| Formula |
C25 H23 N3 O3 |
| Calculated formula |
C25 H23 N3 O3 |
| SMILES |
c1(c(c(c(cc1C)c1ccccc1)n1nnc(c2cc(ccc2)C)c1)O)C(=O)OCC |
| Title of publication |
A Convenient Synthesis of 1-Aryl-1H-1,2,3-triazoles from Aliphatic Substrates |
| Authors of publication |
Wang, Qiang; Shi, Xiaonan; Zhang, Xinying; Fan, Xuesen |
| Journal of publication |
Org. Biomol. Chem. |
| Year of publication |
2017 |
| a |
9.4549 ± 0.0011 Å |
| b |
10.764 ± 0.0012 Å |
| c |
21.279 ± 0.003 Å |
| α |
90° |
| β |
98.778 ± 0.002° |
| γ |
90° |
| Cell volume |
2140.3 ± 0.5 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1068 |
| Residual factor for significantly intense reflections |
0.0498 |
| Weighted residual factors for significantly intense reflections |
0.1102 |
| Weighted residual factors for all reflections included in the refinement |
0.1408 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.004 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7155889.html