Information card for entry 7157916
| Formula |
C7 H11 Cl2 N3 O |
| Calculated formula |
C7 H11 Cl2 N3 O |
| SMILES |
Oc1c([NH3+])ccc(c1)C(=[NH2+])N.[Cl-].[Cl-] |
| Title of publication |
Amidino substituted 2-aminophenols: biologically important building blocks for the amidino-functionalization of 2-substituted benzoxazoles. |
| Authors of publication |
Ptiček, Lucija; Hok, Lucija; Grbčić, Petra; Topić, Filip; Cetina, Mario; Rissanen, Kari; Pavelić, Sandra Kraljević; Vianello, Robert; Racané, Livio |
| Journal of publication |
Organic & biomolecular chemistry |
| Year of publication |
2021 |
| Journal volume |
19 |
| Journal issue |
12 |
| Pages of publication |
2784 - 2793 |
| a |
4.4199 ± 0.0003 Å |
| b |
11.7058 ± 0.0006 Å |
| c |
20.2357 ± 0.0015 Å |
| α |
90° |
| β |
93.014 ± 0.006° |
| γ |
90° |
| Cell volume |
1045.52 ± 0.12 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0472 |
| Residual factor for significantly intense reflections |
0.0376 |
| Weighted residual factors for significantly intense reflections |
0.0908 |
| Weighted residual factors for all reflections included in the refinement |
0.0966 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.066 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7157916.html