Information card for entry 7200793
| Common name |
4,4'-diphenylethnyl-2,2'-bipyridine, hexafluorobenzene |
| Chemical name |
4,4'-diphenylethnyl-2,2'-bipyridine, hexafluorobenzene |
| Formula |
C32 H16 F6 N2 |
| Calculated formula |
C32 H16 F6 N2 |
| SMILES |
c1(nccc(C#Cc2ccccc2)c1)c1cc(ccn1)C#Cc1ccccc1.Fc1c(F)c(F)c(F)c(F)c1F |
| Title of publication |
Luminescence from π–π stacked bipyridines through arene–perfluoroarene interactions |
| Authors of publication |
Hori, Akiko; Takatani, Shohei; Miyamoto, Takeshi K.; Hasegawa, Miki |
| Journal of publication |
CrystEngComm |
| Year of publication |
2009 |
| Journal volume |
11 |
| Journal issue |
4 |
| Pages of publication |
567 |
| a |
10.7927 ± 0.0012 Å |
| b |
11.3308 ± 0.0013 Å |
| c |
10.4449 ± 0.0012 Å |
| α |
90° |
| β |
107.464 ± 0.001° |
| γ |
90° |
| Cell volume |
1218.4 ± 0.2 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0513 |
| Residual factor for significantly intense reflections |
0.0367 |
| Weighted residual factors for significantly intense reflections |
0.0965 |
| Weighted residual factors for all reflections included in the refinement |
0.1155 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.092 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7200793.html
