Information card for entry 7203600
| Formula |
C30 H28 N2 O4 |
| Calculated formula |
C30 H28 N2 O4 |
| SMILES |
O(c1ccc(c(/C=C/c2cc(c3cc(ccn3)/C=C/c3cc(OC)ccc3OC)ncc2)c1)OC)C |
| Title of publication |
Efficient blue light-emitting diodes based on a classical ?push?pull? architecture molecule 4,4?-di-(2-(2,5-dimethoxyphenyl)ethenyl)-2,2?-bipyridine |
| Authors of publication |
Berner, D.; Klein, C.; Nazeeruddin, Md. K.; De Angelis, Filippo; Castellani, M.; Bugnon, Ph.; Scopelliti, R.; Zuppiroli, L.; Graetzel, M. |
| Journal of publication |
Journal of Materials Chemistry |
| Year of publication |
2006 |
| Journal volume |
16 |
| Journal issue |
46 |
| Pages of publication |
4468 |
| a |
7.667 ± 0.0008 Å |
| b |
13.7182 ± 0.0013 Å |
| c |
11.7334 ± 0.0008 Å |
| α |
90° |
| β |
99.379 ± 0.007° |
| γ |
90° |
| Cell volume |
1217.59 ± 0.19 Å3 |
| Cell temperature |
140 ± 2 K |
| Ambient diffraction temperature |
140 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0873 |
| Residual factor for significantly intense reflections |
0.0349 |
| Weighted residual factors for significantly intense reflections |
0.063 |
| Weighted residual factors for all reflections included in the refinement |
0.074 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.865 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7203600.html