Information card for entry 7203972
| Formula |
C25 H30 N2 O4 S |
| Calculated formula |
C25 H30 N2 O4 S |
| SMILES |
S(=O)(=O)([O-])c1ccc(cc1)C.[n+]1(C)ccc(cc1)/C=C/c1ccc(N(CC)CCO)cc1 |
| Title of publication |
Synthesis, structures and two-photon pumped up-conversion lasing properties of two new organic salts |
| Authors of publication |
Ren, Yan; Fang, Qi; Yu, Wen-Tao; Lei, Hong; Tian, Yu-Peng; Jiang, Min-Hua; Yang, Qing-Chuan; Mak, Thomas C. W. |
| Journal of publication |
Journal of Materials Chemistry |
| Year of publication |
2000 |
| Journal volume |
10 |
| Journal issue |
9 |
| Pages of publication |
2025 |
| a |
9.4237 ± 0.0008 Å |
| b |
9.6976 ± 0.0008 Å |
| c |
13.2841 ± 0.0009 Å |
| α |
86.655 ± 0.006° |
| β |
74.064 ± 0.005° |
| γ |
85.891 ± 0.007° |
| Cell volume |
1163.39 ± 0.16 Å3 |
| Cell temperature |
568 ± 2 K |
| Ambient diffraction temperature |
568 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0842 |
| Residual factor for significantly intense reflections |
0.0573 |
| Weighted residual factors for significantly intense reflections |
0.1575 |
| Weighted residual factors for all reflections included in the refinement |
0.1832 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.987 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7203972.html
