Information card for entry 7210521
| Common name |
1,2-Bis-(4-methoxy-phenyl)-ethane-1,2-dione monooxime NEt3 |
| Chemical name |
1,2-Bis-(4-methoxy-phenyl)-ethane-1,2-dione monooxime NEt3 |
| Formula |
C22 H30 N2 O4 |
| Calculated formula |
C22 H30 N2 O4 |
| SMILES |
O=C(c1ccc(OC)cc1)/C(=N\O)c1ccc(OC)cc1.N(CC)(CC)CC |
| Title of publication |
Crystal structures of benzil monoximes controlled through configurational isomerism, molecular substitution and external complexation |
| Authors of publication |
Klein, Cornelia; Fischer, Conrad; Seichter, Wilhelm; Schwarzer, Anke; Weber, Edwin |
| Journal of publication |
CrystEngComm |
| Year of publication |
2011 |
| Journal volume |
13 |
| Journal issue |
6 |
| Pages of publication |
1931 |
| a |
19.219 ± 0.003 Å |
| b |
11.4306 ± 0.0012 Å |
| c |
19.51 ± 0.003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
4286 ± 1 Å3 |
| Cell temperature |
93 ± 2 K |
| Ambient diffraction temperature |
93 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0774 |
| Residual factor for significantly intense reflections |
0.0443 |
| Weighted residual factors for significantly intense reflections |
0.1007 |
| Weighted residual factors for all reflections included in the refinement |
0.1111 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.066 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7210521.html