Information card for entry 7210690
| Formula |
C53 H40 Co N10 O S2 |
| Calculated formula |
C53 H40 Co N10 O S2 |
| SMILES |
[Co]12([n]3c(cc(c4ccc(n5nccc5)cc4)cc3c3ccccc3)c3[n]1cccc3)([n]1c(c3ccccc3)cc(cc1c1[n]2cccc1)c1ccc(n2nccc2)cc1)(N=C=S)N=C=S.OC |
| Title of publication |
Metal cation- and anion-induced assembly: structures and luminescent properties |
| Authors of publication |
Jin, Feng; Wang, Hui-Zhen; Zhang, Ying; Wang, Yang; Zhang, Jun; Kong, Lin; Hao, Fu-Ying; Yang, Jia-Xiang; Wu, Jie-Ying; Tian, Yu-Peng; Zhou, Hong-Ping |
| Journal of publication |
CrystEngComm |
| Year of publication |
2013 |
| Journal volume |
15 |
| Journal issue |
18 |
| Pages of publication |
3687 |
| a |
12.194 ± 0.005 Å |
| b |
12.533 ± 0.005 Å |
| c |
15.864 ± 0.005 Å |
| α |
86.325 ± 0.005° |
| β |
71.489 ± 0.005° |
| γ |
87.781 ± 0.005° |
| Cell volume |
2293.9 ± 1.5 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0487 |
| Residual factor for significantly intense reflections |
0.0392 |
| Weighted residual factors for significantly intense reflections |
0.1297 |
| Weighted residual factors for all reflections included in the refinement |
0.1442 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.087 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7210690.html
