Information card for entry 7211436
| Formula |
C21 H16 F2 O3 |
| Calculated formula |
C21 H16 F2 O3 |
| SMILES |
c1(ccc(F)cc1)c1cc(O)c(C(=O)OCC)c(c1)c1ccc(F)cc1 |
| Title of publication |
Pseudosymmetry, polymorphism and weak interactions: 4,4′′-difluoro-5′-hydroxy-1,1′:3′,1′′-terphenyl-4′-carboxylic acid and its derivatives |
| Authors of publication |
Owczarzak, Anita M.; Samshuddin, Seranthimata; Narayana, Badiadka; Yathirajan, Hemmige S.; Kubicki, Maciej |
| Journal of publication |
CrystEngComm |
| Year of publication |
2013 |
| Journal volume |
15 |
| Journal issue |
46 |
| Pages of publication |
9893 |
| a |
6.9778 ± 0.0003 Å |
| b |
11.1289 ± 0.0005 Å |
| c |
11.5383 ± 0.0005 Å |
| α |
96.213 ± 0.003° |
| β |
98.252 ± 0.004° |
| γ |
93.542 ± 0.004° |
| Cell volume |
878.8 ± 0.07 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0853 |
| Residual factor for significantly intense reflections |
0.048 |
| Weighted residual factors for significantly intense reflections |
0.1007 |
| Weighted residual factors for all reflections included in the refinement |
0.1134 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.983 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7211436.html
