Information card for entry 7217689
| Formula |
C18 H24 F3 N3 O3 |
| Calculated formula |
C18 H24 F3 N3 O3 |
| SMILES |
FC(C(=O)Nc1cc(NC(=O)C(F)(C)C)cc(NC(=O)C(F)(C)C)c1)(C)C |
| Title of publication |
Influence of fluorine side-group substitution on the crystal structure formation of benzene-1,3,5-trisamides |
| Authors of publication |
Zehe, Christoph; Schmidt, Marko; Siegel, Renée; Kreger, Klaus; Daebel, Venita; Ganzleben, Sandra; Schmidt, Hans-Werner; Senker, Jürgen |
| Journal of publication |
CrystEngComm |
| Year of publication |
2014 |
| Journal volume |
16 |
| Journal issue |
39 |
| Pages of publication |
9273 |
| a |
11.8863 ± 0.0044 Å |
| b |
15.3948 ± 0.0059 Å |
| c |
10.5539 ± 0.004 Å |
| α |
90° |
| β |
95.0116 ± 0.0023° |
| γ |
90° |
| Cell volume |
1923.8 ± 1.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Diffraction radiation wavelength |
1.54056 Å |
| Diffraction radiation type |
CuKα1 |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7217689.html