Information card for entry 7220130
| Formula |
C6 H12 N10 O8 Zn |
| Calculated formula |
C6 H12 N10 O8 Zn |
| SMILES |
[OH2][Zn](OC(=O)Cn1c(nnn1)N)(OC(=O)Cn1c(nnn1)N)([OH2])([OH2])[OH2] |
| Title of publication |
Substituted group directed assembly of zinc coordination compounds based on bifunctional ligands, from mono, di to tristetrazole-carboxylate |
| Authors of publication |
Li, Qiao-Yun; Tian, He; Li, Xiu Yun; Zou, Jian Hua; Mei, Guo Dong; Qiu, Li Jun; Wei, Bo; Yang, Gao-Wen |
| Journal of publication |
RSC Adv. |
| Year of publication |
2015 |
| a |
6.1124 ± 0.0012 Å |
| b |
6.6178 ± 0.0013 Å |
| c |
9.6089 ± 0.0019 Å |
| α |
78.7 ± 0.03° |
| β |
82.88 ± 0.03° |
| γ |
75.59 ± 0.03° |
| Cell volume |
368 ± 0.14 Å3 |
| Cell temperature |
291 ± 2 K |
| Ambient diffraction temperature |
291 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.047 |
| Residual factor for significantly intense reflections |
0.043 |
| Weighted residual factors for significantly intense reflections |
0.1506 |
| Weighted residual factors for all reflections included in the refinement |
0.153 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.244 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7220130.html
