Information card for entry 7225955
| Formula |
C14 H7 N3 O2 S |
| Calculated formula |
C14 H7 N3 O2 S |
| SMILES |
s1nc2c(N3C(=O)c4ccccc4C3=O)cccc2n1 |
| Title of publication |
A highly sensitive fluorescent probe for detection of hydrazine in gas and solution phase based on the Gabriel mechanism and its bioimaging |
| Authors of publication |
Maji, Rajkishor; Mahapatra, Ajit Kumar; Maiti, Kalipada; Mondal, Sanchita; Ali, Syed Samim; Sahoo, Prithidipa; Mandal, Sukhendu; Uddin, Md. Raihan; Goswami, Shyamaprosad; Quah, Ching Kheng; Fun, Hoong- Kun |
| Journal of publication |
RSC Adv. |
| Year of publication |
2016 |
| a |
7.5691 ± 0.0009 Å |
| b |
8.3593 ± 0.001 Å |
| c |
10.1479 ± 0.0012 Å |
| α |
83.336 ± 0.002° |
| β |
88.008 ± 0.002° |
| γ |
67.085 ± 0.001° |
| Cell volume |
587.38 ± 0.12 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.042 |
| Residual factor for significantly intense reflections |
0.0371 |
| Weighted residual factors for significantly intense reflections |
0.0923 |
| Weighted residual factors for all reflections included in the refinement |
0.096 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.059 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7225955.html