Information card for entry 7227001
| Common name |
siprobichroman dianhydride |
| Chemical name |
4,4,4',4'-tetramethyl-3,3',4,4'-tetrahydro-2,2'-spirobi[furo[3,4-g]chromene]-6,6',8,8'-tetraone |
| Formula |
C25 H20 O8 |
| Calculated formula |
C25 H20 O8 |
| SMILES |
O1c2cc3C(=O)OC(=O)c3cc2C(CC21Oc1c(C(C2)(C)C)cc2C(=O)OC(=O)c2c1)(C)C |
| Title of publication |
A strategy for preparing spirobichroman dianhydride from bisphenol A and its resulting polyimide with low dielectric characteristic |
| Authors of publication |
Tang, I-Chun; Wang, Meng Wei; Wu, Chien-Hsin; Dai, Shenghong A.; Jeng, Ru-Jong; Lin, Ching_Husuan |
| Journal of publication |
RSC Adv. |
| Year of publication |
2016 |
| a |
26.146 ± 0.002 Å |
| b |
10.396 ± 0.0005 Å |
| c |
20.1104 ± 0.0016 Å |
| α |
90° |
| β |
127.778 ± 0.012° |
| γ |
90° |
| Cell volume |
4320.5 ± 0.9 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0883 |
| Residual factor for significantly intense reflections |
0.0529 |
| Weighted residual factors for significantly intense reflections |
0.1014 |
| Weighted residual factors for all reflections included in the refinement |
0.1176 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.024 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7227001.html