Information card for entry 7228347
| Formula |
C18 H27 N5 O |
| Calculated formula |
C18 H27 N5 O |
| SMILES |
C1CNCCCNCCN[C@@H]2CN1[C@@H]1c3c(C(=O)N1C2)cccc3.C1CNCCCNCCN[C@H]2CN1[C@H]1c3c(C(=O)N1C2)cccc3 |
| Title of publication |
Straightforward synthesis of bis-tetraazacycloalkanes: towards new potential CXCR4 antagonists? |
| Authors of publication |
Sok, Nicolas; Baglin, Isabelle; Basset, Christelle; Fakkor, Fatima; Kohli, Evelyne; Rousselin, Yoann; Bernhard, Claire; Boschetti, Frédéric; Goze, Christine; Denat, Franck |
| Journal of publication |
RSC Adv. |
| Year of publication |
2017 |
| Journal volume |
7 |
| Journal issue |
45 |
| Pages of publication |
28291 |
| a |
13.2517 ± 0.0005 Å |
| b |
12.3383 ± 0.0004 Å |
| c |
12.0306 ± 0.0004 Å |
| α |
90° |
| β |
114.684 ± 0.001° |
| γ |
90° |
| Cell volume |
1787.31 ± 0.11 Å3 |
| Cell temperature |
115 ± 2 K |
| Ambient diffraction temperature |
115 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1066 |
| Residual factor for significantly intense reflections |
0.0507 |
| Weighted residual factors for significantly intense reflections |
0.1009 |
| Weighted residual factors for all reflections included in the refinement |
0.118 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.022 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7228347.html