Information card for entry 7228380
| Common name |
1,1',1''-(2,4,6-triethylbenzene-1,3,5-triyl)tris(methylene) triindoline-2,3-dione |
| Chemical name |
1,1',1''-(2,4,6-triethylbenzene-1,3,5-triyl)tris(methylene) tris(5-methoxyindoline-2,3-dione |
| Formula |
C44 H42 N4 O9 |
| Calculated formula |
C44 H42 N4 O9 |
| SMILES |
O=C1N(Cc2c(c(c(c(c2CC)CN2C(=O)C(=O)c3cc(OC)ccc23)CC)CN2C(=O)C(=O)c3cc(OC)ccc23)CC)c2c(C1=O)cc(OC)cc2.C(#N)C |
| Title of publication |
Conformations of benzene-based tripodal isatin-bearing compounds in the crystalline state |
| Authors of publication |
Mazik, Monika; Schulze, Mathias M.; Schwarzer, Anke |
| Journal of publication |
CrystEngComm |
| Year of publication |
2017 |
| a |
14.4301 ± 0.0004 Å |
| b |
13.512 ± 0.0005 Å |
| c |
19.5432 ± 0.0007 Å |
| α |
90° |
| β |
99.6261 ± 0.0019° |
| γ |
90° |
| Cell volume |
3756.9 ± 0.2 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0771 |
| Residual factor for significantly intense reflections |
0.0589 |
| Weighted residual factors for significantly intense reflections |
0.1594 |
| Weighted residual factors for all reflections included in the refinement |
0.1693 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.041 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7228380.html