Information card for entry 7228551
| Formula |
C20 H8 F3 I3 N2 |
| Calculated formula |
C20 H8 F3 I3 N2 |
| SMILES |
Ic1c(F)c(I)c(F)c(I)c1F.n1ccc(cc1)C#CC#Cc1ccncc1 |
| Title of publication |
Halogen bond cocrystal polymorphs of the 1,4–di(4’–pyridyl)–1,3–diacetylene |
| Authors of publication |
Zhang, Pan; Bolla, Geetha; Qiu, Gege; Shu, Zhibin; Yan, Qingqing; Li, Qingyuan; Ding, Shang; Ni, Zhenjie; Zhu, Weigang; dong, huanli; Zhen, Yonggang; Hu, Wenping |
| Journal of publication |
CrystEngComm |
| Year of publication |
2017 |
| a |
6.6699 ± 0.0005 Å |
| b |
34.308 ± 0.003 Å |
| c |
9.1378 ± 0.001 Å |
| α |
90° |
| β |
102.639 ± 0.005° |
| γ |
90° |
| Cell volume |
2040.3 ± 0.3 Å3 |
| Cell temperature |
173.15 K |
| Ambient diffraction temperature |
173.15 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0351 |
| Residual factor for significantly intense reflections |
0.0316 |
| Weighted residual factors for significantly intense reflections |
0.0614 |
| Weighted residual factors for all reflections included in the refinement |
0.063 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.201 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7228551.html