Information card for entry 7229448
| Formula |
C24 H26 Br2 N2 O4 |
| Calculated formula |
C24 H26 Br2 N2 O4 |
| SMILES |
BrC1=C(O)C(=O)C(Br)=C([O-])C1=O.[nH+]1c(cc(cc1)C(C)(C)C)c1nccc(c1)C(C)(C)C |
| Title of publication |
Structures and phase transitions in the neat 4,4'-di-tert-butyl-2,2'-bipyridyl and in its molecular complexes with either brom- or iodanilic acid |
| Authors of publication |
Rok, Magdalena; Szklarz, Przemyslaw; Moskwa, Marcin; Kijewska, Monika; Baran, Jan; Bator, Grazyna; Medycki, Wojciech; Zamponi, Michaela |
| Journal of publication |
CrystEngComm |
| Year of publication |
2017 |
| a |
8.951 ± 0.003 Å |
| b |
11.491 ± 0.005 Å |
| c |
11.91 ± 0.003 Å |
| α |
98.84 ± 0.03° |
| β |
104.58 ± 0.06° |
| γ |
93.42 ± 0.04° |
| Cell volume |
1165.3 ± 0.8 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1129 |
| Residual factor for significantly intense reflections |
0.0685 |
| Weighted residual factors for significantly intense reflections |
0.1627 |
| Weighted residual factors for all reflections included in the refinement |
0.1757 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.913 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7229448.html