Information card for entry 7240215
| Formula |
C31 H28 N2 O2 |
| Calculated formula |
C31 H28 N2 O2 |
| SMILES |
O1c2c(N(c3c1cccc3)c1c3c(N(c4c(C3=O)cccc4)CCCCCC)ccc1)cccc2 |
| Title of publication |
Effect of the substituent position on the electrochemical, optical and structural properties of donor-acceptor type acridone derivatives. |
| Authors of publication |
Kulszewicz-Bajer, Irena; Zagorska, Malgorzata; Banasiewicz, Marzena; Guńka, Piotr A; Toman, Petr; Kozankiewicz, Boleslaw; Wiosna-Salyga, Gabriela; Pron, Adam |
| Journal of publication |
Physical chemistry chemical physics : PCCP |
| Year of publication |
2020 |
| Journal volume |
22 |
| Journal issue |
16 |
| Pages of publication |
8522 - 8534 |
| a |
9.3283 ± 0.0007 Å |
| b |
10.2674 ± 0.0008 Å |
| c |
13.0289 ± 0.0009 Å |
| α |
79.338 ± 0.006° |
| β |
87.728 ± 0.006° |
| γ |
73.749 ± 0.007° |
| Cell volume |
1177.23 ± 0.16 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0951 |
| Residual factor for significantly intense reflections |
0.0512 |
| Weighted residual factors for significantly intense reflections |
0.1261 |
| Weighted residual factors for all reflections included in the refinement |
0.1545 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.011 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7240215.html
