Information card for entry 7240593
| Chemical name |
2-(3-ethyl-4,5,6,7-tetrahydro-2H-indazol-2-yl)-6-methylpyrimidin-4(3H)-one |
| Formula |
C14 H18 N4 O |
| Calculated formula |
C14 H18 N4 O |
| SMILES |
c1(=O)cc(C)nc([nH]1)n1c(c2c(CCCC2)n1)CC |
| Title of publication |
Pyrazolyl-pyrimidones inhibit the function of human solute carrier protein SLC11A2 (hDMT1) by metal chelation |
| Authors of publication |
Poirier, Marion; Pujol-Giménez, Jonai; Manatschal, Cristina; Bühlmann, Sven; Embaby, Ahmed; Javor, Sacha; Hediger, Matthias A.; Reymond, Jean-Louis |
| Journal of publication |
RSC Medicinal Chemistry |
| Year of publication |
2020 |
| a |
18.8002 ± 0.0002 Å |
| b |
9.6241 ± 0.0001 Å |
| c |
14.373 ± 0.0002 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2600.58 ± 0.05 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
60 |
| Hermann-Mauguin space group symbol |
P b c n |
| Hall space group symbol |
-P 2n 2ab |
| Residual factor for all reflections |
0.044 |
| Residual factor for significantly intense reflections |
0.0355 |
| Weighted residual factors for significantly intense reflections |
0.0871 |
| Weighted residual factors for all reflections included in the refinement |
0.0938 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.043 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7240593.html