Information card for entry 7240891
| Common name |
cis-22a |
| Chemical name |
1-(pyridin-3-yl)-4-((1s,4s)-4-(m-tolyl)cyclohexyl)piperazine |
| Formula |
C22 H29 N3 |
| Calculated formula |
C22 H29 N3 |
| SMILES |
N1(C2CCC(c3cccc(c3)C)CC2)CCN(c2cccnc2)CC1 |
| Title of publication |
Natural product inspired optimization of a selective TRPV6 calcium channel inhibitor |
| Authors of publication |
Cunha, Micael Rodrigues; Bhardwaj, Rajesh; Carrel, Aline Lucie; Lindinger, Sonja; Romanin, Christoph; Parise-Filho, Roberto; Hediger, Matthias A.; Reymond, Jean-Louis |
| Journal of publication |
RSC Medicinal Chemistry |
| Year of publication |
2020 |
| a |
7.2232 ± 0.0003 Å |
| b |
8.9059 ± 0.0004 Å |
| c |
15.2815 ± 0.0006 Å |
| α |
96.464 ± 0.003° |
| β |
95.779 ± 0.003° |
| γ |
99.987 ± 0.004° |
| Cell volume |
954.71 ± 0.07 Å3 |
| Cell temperature |
173 ± 0.1 K |
| Ambient diffraction temperature |
173 ± 0.1 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0656 |
| Residual factor for significantly intense reflections |
0.0504 |
| Weighted residual factors for significantly intense reflections |
0.1229 |
| Weighted residual factors for all reflections included in the refinement |
0.1388 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.041 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7240891.html