Information card for entry 7241642
| Formula |
C13 H36 B2 N2 O |
| Calculated formula |
C13 H36 B2 N2 O |
| SMILES |
O1CCCC1.[N](CCC)(CCC)(CCC)[BH2][NH2][BH3] |
| Title of publication |
Syntheses, formation mechanisms and structures of a series of linear diborazanes |
| Authors of publication |
Li, Huizhen; Wang, Ruirui; Kang, Jiaxin; Li, Shujun; Zhou, Ai-Ju; Han, Dong-xue; Guan, Hong-Yu; Austin, Douglas J.; Yue, Yanfeng |
| Journal of publication |
CrystEngComm |
| Year of publication |
2021 |
| Journal volume |
23 |
| Journal issue |
2 |
| Pages of publication |
404 - 410 |
| a |
8.168 ± 0.0006 Å |
| b |
9.1913 ± 0.0006 Å |
| c |
12.2517 ± 0.0008 Å |
| α |
100.972 ± 0.006° |
| β |
106.036 ± 0.006° |
| γ |
90.602 ± 0.006° |
| Cell volume |
865.9 ± 0.11 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0539 |
| Residual factor for significantly intense reflections |
0.0459 |
| Weighted residual factors for significantly intense reflections |
0.1223 |
| Weighted residual factors for all reflections included in the refinement |
0.1306 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.047 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/7241642.html
